![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00 Overview of Modul..> | 2019-01-08 16:40 | 833K | |
| 00 Overview of Modul..> | 2019-01-08 16:36 | 205K | |
| 01 Basic Architectur..> | 2018-12-24 16:55 | 1.7M | |
| 01 Basic Architectur..> | 2018-12-24 16:55 | 495K | |
| 01 Simple Architectu..> | 2018-12-28 16:22 | 360K | |
| 02 Cheesman Daniels ..> | 2018-12-23 14:26 | 1.1M | |
| 02 Cheesman Daniels ..> | 2018-12-23 14:25 | 167K | |
| 02 Cheesman Daniels.pdf | 2018-12-28 16:22 | 190K | |
| 03 Complex Component..> | 2018-12-28 16:21 | 325K | |
| 03 Compound Componen..> | 2018-12-25 14:35 | 1.0M | |
| 03 Compound Componen..> | 2018-12-25 14:35 | 709K | |
| 04 More Styles and C..> | 2018-12-25 15:05 | 1.0M | |
| 04 More Styles and C..> | 2018-12-25 15:04 | 583K | |
| 04 Styles.pdf | 2018-12-28 16:21 | 219K | |
| 05 .NET -- KEATS.pdf | 2018-12-26 16:26 | 1.2M | |
| 05 .NET -- KEATS.pptx | 2018-12-26 16:26 | 438K | |
| 05 .NET.pdf | 2018-12-28 16:21 | 189K | |
| 06 .NET ctd -- KEATS..> | 2018-12-26 16:37 | 1.6M | |
| 06 .NET ctd -- KEATS..> | 2018-12-26 16:33 | 695K | |
| 06 Enterprise Styles..> | 2018-12-28 16:20 | 217K | |
| 07 Enterprise Styles..> | 2018-12-27 15:34 | 878K | |
| 07 Enterprise Styles..> | 2018-12-27 15:33 | 652K | |
| 07 OCL.pdf | 2018-12-28 16:20 | 279K | |
| 08 OCL - KEATS, Spli..> | 2018-12-27 15:49 | 2.1M | |
| 08 OCL - KEATS, Spli..> | 2018-12-27 15:49 | 467K | |
| lecture 9.pdf | 2018-12-28 15:49 | 1.5M | |
| lecture 9.pptx | 2018-12-28 15:48 | 648K | |
| lecture 10.pdf | 2018-12-28 15:58 | 4.4M | |
| lecture 10.pptx | 2018-12-28 15:58 | 1.3M | |